Pie [UNOFFİCİAL]ViperOS V6.5 Pie ROM for the Samsung Galaxy S3 i9300

Hoşgeldiniz <3

DevOtağ, çeşitli Android cihazlar için birtakım geliştirmeler paylaşılan bir geliştirici platformudur. Üye olun ve içeriklerden faydalanın!

Şimdi, Bir Dakikada Kayıt Olun!

hgunduz295

Site Yöneticisi
Staff member
Administrator
Messages
733
Likes
2,078
#1




This is ViperOS



Hakkında:
Biz Brezilyalı bir ekibiz, ViperOS istikrar ve kullanışlı özellikler getirmeyi hedeflemektedir. Gerçek test edilmiş özelliklere, minimal hataya ve Lineage bloat yazılımına sahip olmayan bir ROM arıyorsanız, o zaman burası tam anlamıyla uygun.


Özellikler:

Code:
Durum Çubuğu

* VeriTrafik göstergeleri

* Durum çubuğu öğeleri

* Saat ve tarih

* Batarya ikonu ayarları

* Taşıyıcı etiketi

* Hızlı ayarlar kişiselleştirme

* Kayan bildirimler

* Diğer durum çubuğu ayarları[/B]



[B]Son Kullanılanlar

* Düğme çemberi

* Mizanpaj girintileri[/B]



[B] Kilit ekranı

* Özel kilit ekranı ayarları

* Lockscreen saat tarzı

Sistem

* Güzel tema motoru

* Navbar etkin / devre dışı

* Navbar düğme düzeni

* Donanım anahtarlarını bağlama

* Donanım anahtarları etkinleştir / devre dışı bırak

* Geri düğmesi ile uygulamayı öldür

* Güç menüsü özelleştirme

* Yazı tipi seçicisi

* Pil LED'i




İndirme Bağlantısı:
You need to like this in order to view this content.

Credits & Thanks:
All ViperOS Team
LineageOS team
And all other open source Devs/Teams I may have missed!

Diğer Linkler
 
Last edited:

ManisaTarzanı

Manisa tarzanı
Üye
Messages
173
Likes
141
Location
Manisa
#3




This is ViperOS



Hakkında:
Biz Brezilyalı bir ekibiz, ViperOS istikrar ve kullanışlı özellikler getirmeyi hedeflemektedir. Gerçek test edilmiş özelliklere, minimal hataya ve Lineage bloat yazılımına sahip olmayan bir ROM arıyorsanız, o zaman burası tam anlamıyla uygun.


Özellikler:


Durum Çubuğu [/B][/B][/B][/B][/B][/B][/B][/B]

[B][B][B][B][B][B][B][B]* VeriTrafik göstergeleri
* Durum çubuğu öğeleri
* Saat ve tarih
* Batarya ikonu ayarları
* Taşıyıcı etiketi
* Hızlı ayarlar kişiselleştirme
* Kayan bildirimler
* Diğer durum çubuğu ayarları[/B][/B][/B][/B][/B][/B][/B][/B]

[B][B][B][B][B][B][B][B][B] Son Kullanılanlar
* Düğme çemberi
* Mizanpaj girintileri[/B][/B][/B][/B][/B][/B][/B][/B][/B]

[B][B][B][B][B][B][B][B][B][B] Kilit ekranı
* Özel kilit ekranı ayarları
* Lockscreen saat tarzı[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]

[B][B][B][B][B][B][B][B][B][B][B] Sistem
* Güzel tema motoru
* Navbar etkin / devre dışı
* Navbar düğme düzeni
* Donanım anahtarlarını bağlama
* Donanım anahtarları etkinleştir / devre dışı bırak
* Geri düğmesi ile uygulamayı öldür
* Güç menüsü özelleştirme
* Yazı tipi seçicisi
* Pil LED'i
[/B][/B][/B]





İndirme Bağlantısı:
[Hidden content][Hidden content]
[Hidden content]
[Hidden content]
[Hidden content]
[Hidden content]
[Hidden content]
[Hidden content]

Credits & Thanks:
All ViperOS Team
LineageOS team
And all other open source Devs/Teams I may have missed!

Diğer Linkler
Eline saglik
 
Top